C15H20OS — CID 11118430
1-methyl-4-[(R)-[(1E,3Z)-octa-1,3-dienyl]sulfinyl]benzene (PubChem CID 11118430) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-methyl-4-[(R)-[(1E,3Z)-octa-1,3-dienyl]sulfinyl]benzene.
| Compound Name | 1-methyl-4-[(R)-[(1E,3Z)-octa-1,3-dienyl]sulfinyl]benzene |
|---|---|
| PubChem CID | 11118430 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-methyl-4-[(R)-[(1E,3Z)-octa-1,3-dienyl]sulfinyl]benzene |
| SMILES | CCCC/C=C\C=C\[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20OS/c1-3-4-5-6-7-8-13-17(16)15-11-9-14(2)10-12-15/h6-13H,3-5H2,1-2H3/b7-6-,13-8+/t17-/m1/s1 |
| InChIKey | BNBAIILPFIRCAP-VRQUWGEJSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|