C16H20O3S — CID 102094986
methyl (2E,7E)-8-(4-methylphenyl)sulfinylocta-2,7-dienoate (PubChem CID 102094986) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is methyl (2E,7E)-8-(4-methylphenyl)sulfinylocta-2,7-dienoate.
| Compound Name | methyl (2E,7E)-8-(4-methylphenyl)sulfinylocta-2,7-dienoate |
|---|---|
| PubChem CID | 102094986 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl (2E,7E)-8-(4-methylphenyl)sulfinylocta-2,7-dienoate |
| SMILES | COC(=O)/C=C/CCC/C=C/S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20O3S/c1-14-9-11-15(12-10-14)20(18)13-7-5-3-4-6-8-16(17)19-2/h6-13H,3-5H2,1-2H3/b8-6+,13-7+ |
| InChIKey | QBBGGTVWVDHLRT-NQSFVOBFSA-N |
| XLogP | 3.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|