C10H8Cl2O3S — CID 106436088
methyl (E)-3-(3,4-dichlorophenyl)sulfinylprop-2-enoate (PubChem CID 106436088) has the molecular formula C10H8Cl2O3S and a molecular weight of 279.14 g/mol. Its IUPAC name is methyl (E)-3-(3,4-dichlorophenyl)sulfinylprop-2-enoate.
| Compound Name | methyl (E)-3-(3,4-dichlorophenyl)sulfinylprop-2-enoate |
|---|---|
| PubChem CID | 106436088 |
| Molecular Formula | C10H8Cl2O3S |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | methyl (E)-3-(3,4-dichlorophenyl)sulfinylprop-2-enoate |
| SMILES | COC(=O)/C=C/S(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2O3S/c1-15-10(13)4-5-16(14)7-2-3-8(11)9(12)6-7/h2-6H,1H3/b5-4+ |
| InChIKey | HMWDCWJDGDVMMK-SNAWJCMRSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|