C16H13Cl2NO4S — CID 59820149
methyl (E)-3-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]prop-2-enoate (PubChem CID 59820149) has the molecular formula C16H13Cl2NO4S and a molecular weight of 386.26 g/mol. Its IUPAC name is methyl (E)-3-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59820149 |
| Molecular Formula | C16H13Cl2NO4S |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | methyl (E)-3-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccccc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO4S/c1-23-16(20)9-6-11-4-2-3-5-15(11)19-24(21,22)12-7-8-13(17)14(18)10-12/h2-10,19H,1H3/b9-6+ |
| InChIKey | PPFYKJHKBYOOPB-RMKNXTFCSA-N |
| XLogP | 3.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|