C18H22O2S — CID 166449544
[(4E,6E)-undeca-4,6-dien-2-ynyl] (S)-4-methylbenzenesulfinate (PubChem CID 166449544) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is [(4E,6E)-undeca-4,6-dien-2-ynyl] (S)-4-methylbenzenesulfinate.
| Compound Name | [(4E,6E)-undeca-4,6-dien-2-ynyl] (S)-4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 166449544 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(4E,6E)-undeca-4,6-dien-2-ynyl] (S)-4-methylbenzenesulfinate |
| SMILES | CCCC/C=C/C=C/C#CCO[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22O2S/c1-3-4-5-6-7-8-9-10-11-16-20-21(19)18-14-12-17(2)13-15-18/h6-9,12-15H,3-5,16H2,1-2H3/b7-6+,9-8+/t21-/m0/s1 |
| InChIKey | WFKGLGBUDUIQKI-YGDVUYPLSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|