About oct-2-ynyl (S)-4-methylbenzenesulfinate
oct-2-ynyl (S)-4-methylbenzenesulfinate (PubChem CID 166449595) has the molecular formula C15H20O2S
and a molecular weight of 264.39 g/mol. Its IUPAC name is oct-2-ynyl (S)-4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | oct-2-ynyl (S)-4-methylbenzenesulfinate |
| PubChem CID | 166449595 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | oct-2-ynyl (S)-4-methylbenzenesulfinate |
| SMILES | CCCCCC#CCO[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O2S/c1-3-4-5-6-7-8-13-17-18(16)15-11-9-14(2)10-12-15/h9-12H,3-6,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | DDLZRBRWEBZCBP-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-2-ynyl (S)-4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-2-ynyl (S)-4-methylbenzenesulfinate?
The IUPAC name of oct-2-ynyl (S)-4-methylbenzenesulfinate (CID 166449595) is oct-2-ynyl (S)-4-methylbenzenesulfinate.
What is the SMILES notation for oct-2-ynyl (S)-4-methylbenzenesulfinate?
The canonical SMILES for oct-2-ynyl (S)-4-methylbenzenesulfinate is CCCCCC#CCO[S@](=O)c1ccc(C)cc1.
What is the InChIKey of oct-2-ynyl (S)-4-methylbenzenesulfinate?
The InChIKey is DDLZRBRWEBZCBP-SFHVURJKSA-N. The full InChI is InChI=1S/C15H20O2S/c1-3-4-5-6-7-8-13-17-18(16)15-11-9-14(2)10-12-15/h9-12H,3-6,13H2,1-2H3/t18-/m0/s1.
What are the key properties of oct-2-ynyl (S)-4-methylbenzenesulfinate?
oct-2-ynyl (S)-4-methylbenzenesulfinate has a molecular weight of 264.39 g/mol, XLogP of 3.62, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-2-ynyl (S)-4-methylbenzenesulfinate is sourced from PubChem (CID 166449595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).