C20H27IN2O6S — CID 11272827
2-[[(3aR,5S,7aS)-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-(4-methylphenyl)sulfonylamino]-N-methoxy-N-methylacetamide (PubChem CID 11272827) has the molecular formula C20H27IN2O6S and a molecular weight of 550.42 g/mol. Its IUPAC name is 2-[[(3aR,5S,7aS)-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-(4-methylphenyl)sulfonylamino]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[[(3aR,5S,7aS)-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-(4-methylphenyl)sulfonylamino]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 11272827 |
| Molecular Formula | C20H27IN2O6S |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 2-[[(3aR,5S,7aS)-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-(4-methylphenyl)sulfonylamino]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)CN([C@H]1C[C@H]2OC(C)(C)O[C@H]2C=C1I)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H27IN2O6S/c1-13-6-8-14(9-7-13)30(25,26)23(12-19(24)22(4)27-5)16-11-18-17(10-15(16)21)28-20(2,3)29-18/h6-10,16-18H,11-12H2,1-5H3/t16-,17-,18+/m0/s1 |
| InChIKey | DBYUCVCQGIFXLX-OKZBNKHCSA-N |
| XLogP | 2.62 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|