C15H20O4S2 — CID 10860447
(3aR,6S,7aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole (PubChem CID 10860447) has the molecular formula C15H20O4S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (3aR,6S,7aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole.
| Compound Name | (3aR,6S,7aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 10860447 |
| Molecular Formula | C15H20O4S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (3aR,6S,7aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2C[C@H]3OC(C)(C)O[C@H]3CS2)cc1 |
| InChI | InChI=1S/C15H20O4S2/c1-10-4-6-11(7-5-10)21(16,17)14-8-12-13(9-20-14)19-15(2,3)18-12/h4-7,12-14H,8-9H2,1-3H3/t12-,13+,14+/m1/s1 |
| InChIKey | UMMDIAHOZRUXQV-RDBSUJKOSA-N |
| XLogP | 2.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |