About 2-(4-methylphenyl)sulfonyl-1,4-dithiane
2-(4-methylphenyl)sulfonyl-1,4-dithiane (PubChem CID 87982861) has the molecular formula C11H14O2S3
and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-1,4-dithiane.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)sulfonyl-1,4-dithiane |
| PubChem CID | 87982861 |
| Molecular Formula | C11H14O2S3 |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-1,4-dithiane |
| SMILES | Cc1ccc(S(=O)(=O)C2CSCCS2)cc1 |
| InChI | InChI=1S/C11H14O2S3/c1-9-2-4-10(5-3-9)16(12,13)11-8-14-6-7-15-11/h2-5,11H,6-8H2,1H3 |
| InChIKey | DZGQAEXJOMGPAB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methylphenyl)sulfonyl-1,4-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)sulfonyl-1,4-dithiane?
The IUPAC name of 2-(4-methylphenyl)sulfonyl-1,4-dithiane (CID 87982861) is 2-(4-methylphenyl)sulfonyl-1,4-dithiane.
What is the SMILES notation for 2-(4-methylphenyl)sulfonyl-1,4-dithiane?
The canonical SMILES for 2-(4-methylphenyl)sulfonyl-1,4-dithiane is Cc1ccc(S(=O)(=O)C2CSCCS2)cc1.
What is the InChIKey of 2-(4-methylphenyl)sulfonyl-1,4-dithiane?
The InChIKey is DZGQAEXJOMGPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S3/c1-9-2-4-10(5-3-9)16(12,13)11-8-14-6-7-15-11/h2-5,11H,6-8H2,1H3.
What are the key properties of 2-(4-methylphenyl)sulfonyl-1,4-dithiane?
2-(4-methylphenyl)sulfonyl-1,4-dithiane has a molecular weight of 274.43 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)sulfonyl-1,4-dithiane is sourced from PubChem (CID 87982861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).