C11H14O2S3 — CID 87982861
2-(4-methylphenyl)sulfonyl-1,4-dithiane (PubChem CID 87982861) has the molecular formula C11H14O2S3 and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-1,4-dithiane.
| Compound Name | 2-(4-methylphenyl)sulfonyl-1,4-dithiane |
|---|---|
| PubChem CID | 87982861 |
| Molecular Formula | C11H14O2S3 |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-1,4-dithiane |
| SMILES | Cc1ccc(S(=O)(=O)C2CSCCS2)cc1 |
| InChI | InChI=1S/C11H14O2S3/c1-9-2-4-10(5-3-9)16(12,13)11-8-14-6-7-15-11/h2-5,11H,6-8H2,1H3 |
| InChIKey | DZGQAEXJOMGPAB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |