C16H21NO3 — CID 134860265
2-[(2S,3S)-3-ethenyl-3,5-dimethyl-2H-1-benzofuran-2-yl]-N-methoxy-N-methylacetamide (PubChem CID 134860265) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[(2S,3S)-3-ethenyl-3,5-dimethyl-2H-1-benzofuran-2-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(2S,3S)-3-ethenyl-3,5-dimethyl-2H-1-benzofuran-2-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 134860265 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-[(2S,3S)-3-ethenyl-3,5-dimethyl-2H-1-benzofuran-2-yl]-N-methoxy-N-methylacetamide |
| SMILES | C=C[C@@]1(C)c2cc(C)ccc2O[C@H]1CC(=O)N(C)OC |
| InChI | InChI=1S/C16H21NO3/c1-6-16(3)12-9-11(2)7-8-13(12)20-14(16)10-15(18)17(4)19-5/h6-9,14H,1,10H2,2-5H3/t14-,16-/m0/s1 |
| InChIKey | JGECXXANRVFKPA-HOCLYGCPSA-N |
| XLogP | 2.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|