C22H38O6 — CID 15197336
[(4S,6R)-6-[[(4S,6S)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 15197336) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is [(4S,6R)-6-[[(4S,6S)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4S,6R)-6-[[(4S,6S)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15197336 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | [(4S,6R)-6-[[(4S,6S)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H]1C[C@@H](C[C@@H]2C[C@@H](COC(=O)C(C)(C)C)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C22H38O6/c1-9-10-15-11-16(26-21(5,6)25-15)12-17-13-18(28-22(7,8)27-17)14-24-19(23)20(2,3)4/h9,15-18H,1,10-14H2,2-8H3/t15-,16-,17+,18-/m0/s1 |
| InChIKey | NBWXSJAXIZHWFT-FJIDUMEYSA-N |
| XLogP | 4.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|