C6H10O3 — CID 44541819
(2R,3S)-3-[(1S)-1-methoxyethyl]oxirane-2-carbaldehyde (PubChem CID 44541819) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (2R,3S)-3-[(1S)-1-methoxyethyl]oxirane-2-carbaldehyde.
| Compound Name | (2R,3S)-3-[(1S)-1-methoxyethyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 44541819 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (2R,3S)-3-[(1S)-1-methoxyethyl]oxirane-2-carbaldehyde |
| SMILES | CO[C@@H](C)[C@@H]1O[C@H]1C=O |
| InChI | InChI=1S/C6H10O3/c1-4(8-2)6-5(3-7)9-6/h3-6H,1-2H3/t4-,5-,6-/m0/s1 |
| InChIKey | RRGPZGIJPKARBT-ZLUOBGJFSA-N |
| XLogP | -0.01 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|