C21H40O2 — CID 45378421
(2R,3S)-3-[(2R)-octadecan-2-yl]oxirane-2-carbaldehyde (PubChem CID 45378421) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is (2R,3S)-3-[(2R)-octadecan-2-yl]oxirane-2-carbaldehyde.
| Compound Name | (2R,3S)-3-[(2R)-octadecan-2-yl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 45378421 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | (2R,3S)-3-[(2R)-octadecan-2-yl]oxirane-2-carbaldehyde |
| SMILES | CCCCCCCCCCCCCCCC[C@@H](C)[C@@H]1O[C@H]1C=O |
| InChI | InChI=1S/C21H40O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(2)21-20(18-22)23-21/h18-21H,3-17H2,1-2H3/t19-,20+,21+/m1/s1 |
| InChIKey | KEFHYDWMANAILP-HKBOAZHASA-N |
| XLogP | 6.46 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|