C6H10O5 — CID 21125809
(2R,3R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]oxirane-2-carbaldehyde (PubChem CID 21125809) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is (2R,3R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]oxirane-2-carbaldehyde.
| Compound Name | (2R,3R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 21125809 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (2R,3R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]oxirane-2-carbaldehyde |
| SMILES | O=C[C@@H]1O[C@@H]1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H10O5/c7-1-3(9)5(10)6-4(2-8)11-6/h2-7,9-10H,1H2/t3-,4+,5-,6+/m1/s1 |
| InChIKey | WGLTWYFCHDJTIS-MOJAZDJTSA-N |
| XLogP | -2.33 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|