C5H8O3 — CID 173256593
2-methyl-4-tritio-1,3-dioxolane-4-carbaldehyde (PubChem CID 173256593) has the molecular formula C5H8O3 and a molecular weight of 118.12 g/mol. Its IUPAC name is 2-methyl-4-tritio-1,3-dioxolane-4-carbaldehyde.
| Compound Name | 2-methyl-4-tritio-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 173256593 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 118.12 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 2-methyl-4-tritio-1,3-dioxolane-4-carbaldehyde |
| SMILES | [3H]C1(C=O)COC(C)O1 |
| InChI | InChI=1S/C5H8O3/c1-4-7-3-5(2-6)8-4/h2,4-5H,3H2,1H3/i5T |
| InChIKey | MGJRCILWZGKOON-XHHURNKPSA-N |
| XLogP | -0.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.12 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|