C5H8O4 — CID 175326174
(2-methyl-1,3-dioxolan-4-yl) formate (PubChem CID 175326174) has the molecular formula C5H8O4 and a molecular weight of 132.12 g/mol. Its IUPAC name is (2-methyl-1,3-dioxolan-4-yl) formate.
| Compound Name | (2-methyl-1,3-dioxolan-4-yl) formate |
|---|---|
| PubChem CID | 175326174 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (2-methyl-1,3-dioxolan-4-yl) formate |
| SMILES | CC1OCC(OC=O)O1 |
| InChI | InChI=1S/C5H8O4/c1-4-7-2-5(9-4)8-3-6/h3-5H,2H2,1H3 |
| InChIKey | PJDGKIXLHJQSMA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|