C8H16O4 — CID 138705293
2-[(2-methyl-1,3-dioxolan-4-yl)oxy]butan-1-ol (PubChem CID 138705293) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dioxolan-4-yl)oxy]butan-1-ol.
| Compound Name | 2-[(2-methyl-1,3-dioxolan-4-yl)oxy]butan-1-ol |
|---|---|
| PubChem CID | 138705293 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-[(2-methyl-1,3-dioxolan-4-yl)oxy]butan-1-ol |
| SMILES | CCC(CO)OC1COC(C)O1 |
| InChI | InChI=1S/C8H16O4/c1-3-7(4-9)12-8-5-10-6(2)11-8/h6-9H,3-5H2,1-2H3 |
| InChIKey | USKFOLGGVSGOGM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |