C4H7FO2 — CID 137456725
4-fluoro-2-methyl-1,3-dioxolane (PubChem CID 137456725) has the molecular formula C4H7FO2 and a molecular weight of 106.10 g/mol. Its IUPAC name is 4-fluoro-2-methyl-1,3-dioxolane.
| Compound Name | 4-fluoro-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 137456725 |
| Molecular Formula | C4H7FO2 |
| Molecular Weight | 106.10 g/mol |
| Exact Mass | 106.04 |
| IUPAC Name | 4-fluoro-2-methyl-1,3-dioxolane |
| SMILES | CC1OCC(F)O1 |
| InChI | InChI=1S/C4H7FO2/c1-3-6-2-4(5)7-3/h3-4H,2H2,1H3 |
| InChIKey | BUBRYJCMPIFYOV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.10 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |