C6H10O2S — CID 172574508
1-(2-methyl-1,3-dioxolan-4-yl)ethanethione (PubChem CID 172574508) has the molecular formula C6H10O2S and a molecular weight of 146.21 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dioxolan-4-yl)ethanethione.
| Compound Name | 1-(2-methyl-1,3-dioxolan-4-yl)ethanethione |
|---|---|
| PubChem CID | 172574508 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 1-(2-methyl-1,3-dioxolan-4-yl)ethanethione |
| SMILES | CC(=S)C1COC(C)O1 |
| InChI | InChI=1S/C6H10O2S/c1-4(9)6-3-7-5(2)8-6/h5-6H,3H2,1-2H3 |
| InChIKey | XSZAQUWRYNXFBN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|