C9H14O4 — CID 130142214
(E)-4-(5-hydroxy-2-methyl-1,3-dioxan-4-yl)but-3-en-2-one (PubChem CID 130142214) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (E)-4-(5-hydroxy-2-methyl-1,3-dioxan-4-yl)but-3-en-2-one.
| Compound Name | (E)-4-(5-hydroxy-2-methyl-1,3-dioxan-4-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 130142214 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (E)-4-(5-hydroxy-2-methyl-1,3-dioxan-4-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1OC(C)OCC1O |
| InChI | InChI=1S/C9H14O4/c1-6(10)3-4-9-8(11)5-12-7(2)13-9/h3-4,7-9,11H,5H2,1-2H3/b4-3+ |
| InChIKey | WIYYSJAEAYWKMV-ONEGZZNKSA-N |
| XLogP | 0.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|