C11H22O4 — CID 45095328
2-[2-(4-ethyl-1,3-dioxolan-2-yl)ethoxy]butan-1-ol (PubChem CID 45095328) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-[2-(4-ethyl-1,3-dioxolan-2-yl)ethoxy]butan-1-ol.
| Compound Name | 2-[2-(4-ethyl-1,3-dioxolan-2-yl)ethoxy]butan-1-ol |
|---|---|
| PubChem CID | 45095328 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-[2-(4-ethyl-1,3-dioxolan-2-yl)ethoxy]butan-1-ol |
| SMILES | CCC(CO)OCCC1OCC(CC)O1 |
| InChI | InChI=1S/C11H22O4/c1-3-9(7-12)13-6-5-11-14-8-10(4-2)15-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | ONWLCYWVKWCHLQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |