C12H26O4 — CID 22568338
2-[2-(2-hydroxybutoxy)butoxy]butan-1-ol (PubChem CID 22568338) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[2-(2-hydroxybutoxy)butoxy]butan-1-ol.
| Compound Name | 2-[2-(2-hydroxybutoxy)butoxy]butan-1-ol |
|---|---|
| PubChem CID | 22568338 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-[2-(2-hydroxybutoxy)butoxy]butan-1-ol |
| SMILES | CCC(O)COC(CC)COC(CC)CO |
| InChI | InChI=1S/C12H26O4/c1-4-10(14)8-15-12(6-3)9-16-11(5-2)7-13/h10-14H,4-9H2,1-3H3 |
| InChIKey | YYBRFZQCFWBFLN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |