C12H26O3 — CID 11543074
(2R,4R)-2-ethyl-4-(2-hydroxybutoxy)hexan-1-ol (PubChem CID 11543074) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-4-(2-hydroxybutoxy)hexan-1-ol.
| Compound Name | (2R,4R)-2-ethyl-4-(2-hydroxybutoxy)hexan-1-ol |
|---|---|
| PubChem CID | 11543074 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | (2R,4R)-2-ethyl-4-(2-hydroxybutoxy)hexan-1-ol |
| SMILES | CCC(O)CO[C@H](CC)C[C@@H](CC)CO |
| InChI | InChI=1S/C12H26O3/c1-4-10(8-13)7-12(6-3)15-9-11(14)5-2/h10-14H,4-9H2,1-3H3/t10-,11?,12-/m1/s1 |
| InChIKey | GYNRBXDQGQUJJJ-IGBJHFKCSA-N |
| XLogP | 1.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |