C20H38O8 — CID 123300203
bis[5-(hydroxymethyl)heptan-3-yl] 2,3-dihydroxybutanedioate (PubChem CID 123300203) has the molecular formula C20H38O8 and a molecular weight of 406.52 g/mol. Its IUPAC name is bis[5-(hydroxymethyl)heptan-3-yl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[5-(hydroxymethyl)heptan-3-yl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 123300203 |
| Molecular Formula | C20H38O8 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | bis[5-(hydroxymethyl)heptan-3-yl] 2,3-dihydroxybutanedioate |
| SMILES | CCC(CO)CC(CC)OC(=O)C(O)C(O)C(=O)OC(CC)CC(CC)CO |
| InChI | InChI=1S/C20H38O8/c1-5-13(11-21)9-15(7-3)27-19(25)17(23)18(24)20(26)28-16(8-4)10-14(6-2)12-22/h13-18,21-24H,5-12H2,1-4H3 |
| InChIKey | LOAGDKGBLNOREM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |