2,4-bis(hydroxymethyl)hexanoic acid

C8H16O4 — CID 123629502

IUPAC2,4-bis(hydroxymethyl)hexanoic acid
SMILESCCC(CO)CC(CO)C(=O)O
InChIInChI=1S/C8H16O4/c1-2-6(4-9)3-7(5-10)8(11)12/h6-7,9-10H,2-5H2,1H3,(H,11,12)
InChIKeyHIUJINGJXPOIOG-UHFFFAOYSA-N
MW176.21 g/mol
LogP0.09
Rot. Bonds6

About 2,4-bis(hydroxymethyl)hexanoic acid

2,4-bis(hydroxymethyl)hexanoic acid (PubChem CID 123629502) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2,4-bis(hydroxymethyl)hexanoic acid.

Molecular Properties

Compound Name2,4-bis(hydroxymethyl)hexanoic acid
PubChem CID123629502
Molecular FormulaC8H16O4
Molecular Weight176.21 g/mol
Exact Mass176.10
IUPAC Name2,4-bis(hydroxymethyl)hexanoic acid
SMILESCCC(CO)CC(CO)C(=O)O
InChIInChI=1S/C8H16O4/c1-2-6(4-9)3-7(5-10)8(11)12/h6-7,9-10H,2-5H2,1H3,(H,11,12)
InChIKeyHIUJINGJXPOIOG-UHFFFAOYSA-N
XLogP0.09
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.21
LogP ≤ 50.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,4-bis(hydroxymethyl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-(hydroxymethyl)butanoic acid
CID 11586303
4-hydroxybutane-1,1,3-tricarboxylic acid
CID 123239997
acetic acid;2-ethylpropane-1,3-diol
CID 22936080
ethane;2-ethylbutanoic acid
CID 142229949
2,4-diethylpentane-1,5-diol;bis(pentanoic acid)
CID 175160566
2-butyl-4-ethyloctanoic acid;nickel
CID 87483186
CID 87086045
CID 87086045
CID 123134376
CID 123134376
2-(2-ethylbutyl)-12-methyltridecanoic acid
CID 141197707
(2S)-2-ethylbutanedioic acid
CID 6997245
(4R)-4-(hydroxymethyl)hexanoic acid
CID 131845263
2-(hydroxymethyl)-4-oxohexanoic acid
CID 86044458

Frequently Asked Questions

What is the IUPAC name of 2,4-bis(hydroxymethyl)hexanoic acid?
The IUPAC name of 2,4-bis(hydroxymethyl)hexanoic acid (CID 123629502) is 2,4-bis(hydroxymethyl)hexanoic acid.
What is the SMILES notation for 2,4-bis(hydroxymethyl)hexanoic acid?
The canonical SMILES for 2,4-bis(hydroxymethyl)hexanoic acid is CCC(CO)CC(CO)C(=O)O.
What is the InChIKey of 2,4-bis(hydroxymethyl)hexanoic acid?
The InChIKey is HIUJINGJXPOIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-2-6(4-9)3-7(5-10)8(11)12/h6-7,9-10H,2-5H2,1H3,(H,11,12).
What are the key properties of 2,4-bis(hydroxymethyl)hexanoic acid?
2,4-bis(hydroxymethyl)hexanoic acid has a molecular weight of 176.21 g/mol, XLogP of 0.09, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(hydroxymethyl)hexanoic acid is sourced from PubChem (CID 123629502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).