C15H32O6 — CID 22947936
1-[2,3-bis(2-hydroxybutoxy)propoxy]butan-2-ol (PubChem CID 22947936) has the molecular formula C15H32O6 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[2,3-bis(2-hydroxybutoxy)propoxy]butan-2-ol.
| Compound Name | 1-[2,3-bis(2-hydroxybutoxy)propoxy]butan-2-ol |
|---|---|
| PubChem CID | 22947936 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-[2,3-bis(2-hydroxybutoxy)propoxy]butan-2-ol |
| SMILES | CCC(O)COCC(COCC(O)CC)OCC(O)CC |
| InChI | InChI=1S/C15H32O6/c1-4-12(16)7-19-10-15(21-9-14(18)6-3)11-20-8-13(17)5-2/h12-18H,4-11H2,1-3H3 |
| InChIKey | NBDDSNLJGISUJJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |