C15H32O8 — CID 132556170
1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 132556170) has the molecular formula C15H32O8 and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 132556170 |
| Molecular Formula | C15H32O8 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)COC(COCCOC)COCCOC |
| InChI | InChI=1S/C15H32O8/c1-17-4-7-20-10-14(16)11-23-15(12-21-8-5-18-2)13-22-9-6-19-3/h14-16H,4-13H2,1-3H3 |
| InChIKey | VEUNTBXCDJYBFK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|