C12H24O5Si — CID 101157962
(4R,5R)-5-[tert-butyl(dimethyl)silyl]peroxy-2-methyl-1,3-dioxane-4-carbaldehyde (PubChem CID 101157962) has the molecular formula C12H24O5Si and a molecular weight of 276.40 g/mol. Its IUPAC name is (4R,5R)-5-[tert-butyl(dimethyl)silyl]peroxy-2-methyl-1,3-dioxane-4-carbaldehyde.
| Compound Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]peroxy-2-methyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 101157962 |
| Molecular Formula | C12H24O5Si |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]peroxy-2-methyl-1,3-dioxane-4-carbaldehyde |
| SMILES | CC1OC[C@@H](OO[Si](C)(C)C(C)(C)C)[C@H](C=O)O1 |
| InChI | InChI=1S/C12H24O5Si/c1-9-14-8-11(10(7-13)15-9)16-17-18(5,6)12(2,3)4/h7,9-11H,8H2,1-6H3/t9?,10-,11+/m0/s1 |
| InChIKey | KUMAZMJGGRLAQI-QXXIUIOUSA-N |
| XLogP | 2.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|