C7H13NO4 — CID 21306104
N-hydroxy-N-methyl-2-(2-methyl-1,3-dioxolan-4-yl)acetamide (PubChem CID 21306104) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is N-hydroxy-N-methyl-2-(2-methyl-1,3-dioxolan-4-yl)acetamide.
| Compound Name | N-hydroxy-N-methyl-2-(2-methyl-1,3-dioxolan-4-yl)acetamide |
|---|---|
| PubChem CID | 21306104 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-hydroxy-N-methyl-2-(2-methyl-1,3-dioxolan-4-yl)acetamide |
| SMILES | CC1OCC(CC(=O)N(C)O)O1 |
| InChI | InChI=1S/C7H13NO4/c1-5-11-4-6(12-5)3-7(9)8(2)10/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | XCSKZJSBINRCHA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|