C9H6FNO3 — CID 175121706
3-(4-fluorophenyl)-1,4,2-dioxazole-5-carbaldehyde (PubChem CID 175121706) has the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1,4,2-dioxazole-5-carbaldehyde.
| Compound Name | 3-(4-fluorophenyl)-1,4,2-dioxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 175121706 |
| Molecular Formula | C9H6FNO3 |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 3-(4-fluorophenyl)-1,4,2-dioxazole-5-carbaldehyde |
| SMILES | O=CC1ON=C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C9H6FNO3/c10-7-3-1-6(2-4-7)9-11-14-8(5-12)13-9/h1-5,8H |
| InChIKey | RCYRFUCGEKIZII-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|