C7H7F2NO — CID 143654917
1,4-difluorobenzene;formamide (PubChem CID 143654917) has the molecular formula C7H7F2NO and a molecular weight of 159.14 g/mol. Its IUPAC name is 1,4-difluorobenzene;formamide.
| Compound Name | 1,4-difluorobenzene;formamide |
|---|---|
| PubChem CID | 143654917 |
| Molecular Formula | C7H7F2NO |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 1,4-difluorobenzene;formamide |
| SMILES | Fc1ccc(F)cc1.NC=O |
| InChI | InChI=1S/C6H4F2.CH3NO/c7-5-1-2-6(8)4-3-5;2-1-3/h1-4H;1H,(H2,2,3) |
| InChIKey | CKQQEXXHKKGMAL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|