About 4-fluoroaniline;propanal
4-fluoroaniline;propanal (PubChem CID 143106695) has the molecular formula C9H12FNO
and a molecular weight of 169.20 g/mol. Its IUPAC name is 4-fluoroaniline;propanal.
Molecular Properties
| Compound Name | 4-fluoroaniline;propanal |
| PubChem CID | 143106695 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-fluoroaniline;propanal |
| SMILES | CCC=O.Nc1ccc(F)cc1 |
| InChI | InChI=1S/C6H6FN.C3H6O/c7-5-1-3-6(8)4-2-5;1-2-3-4/h1-4H,8H2;3H,2H2,1H3 |
| InChIKey | ZILITLLNRKDGIX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoroaniline;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoroaniline;propanal?
The IUPAC name of 4-fluoroaniline;propanal (CID 143106695) is 4-fluoroaniline;propanal.
What is the SMILES notation for 4-fluoroaniline;propanal?
The canonical SMILES for 4-fluoroaniline;propanal is CCC=O.Nc1ccc(F)cc1.
What is the InChIKey of 4-fluoroaniline;propanal?
The InChIKey is ZILITLLNRKDGIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C3H6O/c7-5-1-3-6(8)4-2-5;1-2-3-4/h1-4H,8H2;3H,2H2,1H3.
What are the key properties of 4-fluoroaniline;propanal?
4-fluoroaniline;propanal has a molecular weight of 169.20 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoroaniline;propanal is sourced from PubChem (CID 143106695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).