C17H10FNO3 — CID 134149840
2-(4-fluorophenyl)-3a,9a-dihydrobenzo[f][1,3]benzoxazole-4,9-dione (PubChem CID 134149840) has the molecular formula C17H10FNO3 and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3a,9a-dihydrobenzo[f][1,3]benzoxazole-4,9-dione.
| Compound Name | 2-(4-fluorophenyl)-3a,9a-dihydrobenzo[f][1,3]benzoxazole-4,9-dione |
|---|---|
| PubChem CID | 134149840 |
| Molecular Formula | C17H10FNO3 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(4-fluorophenyl)-3a,9a-dihydrobenzo[f][1,3]benzoxazole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)C2OC(c3ccc(F)cc3)=NC12 |
| InChI | InChI=1S/C17H10FNO3/c18-10-7-5-9(6-8-10)17-19-13-14(20)11-3-1-2-4-12(11)15(21)16(13)22-17/h1-8,13,16H |
| InChIKey | MPHSOOSWRQUSHA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|