C22H27BrO — CID 174949054
4-[(2-bromophenyl)methylidene]-2,6-dibutylcyclohexa-2,5-diene-1-carbaldehyde (PubChem CID 174949054) has the molecular formula C22H27BrO and a molecular weight of 387.36 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methylidene]-2,6-dibutylcyclohexa-2,5-diene-1-carbaldehyde.
| Compound Name | 4-[(2-bromophenyl)methylidene]-2,6-dibutylcyclohexa-2,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 174949054 |
| Molecular Formula | C22H27BrO |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[(2-bromophenyl)methylidene]-2,6-dibutylcyclohexa-2,5-diene-1-carbaldehyde |
| SMILES | CCCCC1=CC(=Cc2ccccc2Br)C=C(CCCC)C1C=O |
| InChI | InChI=1S/C22H27BrO/c1-3-5-9-18-13-17(15-20-11-7-8-12-22(20)23)14-19(10-6-4-2)21(18)16-24/h7-8,11-16,21H,3-6,9-10H2,1-2H3/b17-15- |
| InChIKey | QDMBCWXPOYJANL-ICFOKQHNSA-N |
| XLogP | 6.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|