C8H9Cl3O2 — CID 71382427
3,4,5-trichloro-6-propyl-3,4-dihydropyran-2-one (PubChem CID 71382427) has the molecular formula C8H9Cl3O2 and a molecular weight of 243.52 g/mol. Its IUPAC name is 3,4,5-trichloro-6-propyl-3,4-dihydropyran-2-one.
| Compound Name | 3,4,5-trichloro-6-propyl-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 71382427 |
| Molecular Formula | C8H9Cl3O2 |
| Molecular Weight | 243.52 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 3,4,5-trichloro-6-propyl-3,4-dihydropyran-2-one |
| SMILES | CCCC1=C(Cl)C(Cl)C(Cl)C(=O)O1 |
| InChI | InChI=1S/C8H9Cl3O2/c1-2-3-4-5(9)6(10)7(11)8(12)13-4/h6-7H,2-3H2,1H3 |
| InChIKey | FERYLJWSTDSHBQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|