C6H9ClO2 — CID 130935409
(3R,4R)-3-chloro-4-ethyl-4-methyloxetan-2-one (PubChem CID 130935409) has the molecular formula C6H9ClO2 and a molecular weight of 148.59 g/mol. Its IUPAC name is (3R,4R)-3-chloro-4-ethyl-4-methyloxetan-2-one.
| Compound Name | (3R,4R)-3-chloro-4-ethyl-4-methyloxetan-2-one |
|---|---|
| PubChem CID | 130935409 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | (3R,4R)-3-chloro-4-ethyl-4-methyloxetan-2-one |
| SMILES | CC[C@@]1(C)OC(=O)[C@@H]1Cl |
| InChI | InChI=1S/C6H9ClO2/c1-3-6(2)4(7)5(8)9-6/h4H,3H2,1-2H3/t4-,6+/m0/s1 |
| InChIKey | ZEMSIQIVYXCMSZ-UJURSFKZSA-N |
| XLogP | 1.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|