C12H20O3 — CID 10560499
3-acetyl-5,5-diethyl-4,4-dimethyloxolan-2-one (PubChem CID 10560499) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-acetyl-5,5-diethyl-4,4-dimethyloxolan-2-one.
| Compound Name | 3-acetyl-5,5-diethyl-4,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 10560499 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-acetyl-5,5-diethyl-4,4-dimethyloxolan-2-one |
| SMILES | CCC1(CC)OC(=O)C(C(C)=O)C1(C)C |
| InChI | InChI=1S/C12H20O3/c1-6-12(7-2)11(4,5)9(8(3)13)10(14)15-12/h9H,6-7H2,1-5H3 |
| InChIKey | CTPZHXIBXCNQTH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|