C7H10Cl2O3 — CID 131014501
(3S,4S,5S)-3-chloro-5-(chloromethyl)-4-hydroxy-4,5-dimethyloxolan-2-one (PubChem CID 131014501) has the molecular formula C7H10Cl2O3 and a molecular weight of 213.06 g/mol. Its IUPAC name is (3S,4S,5S)-3-chloro-5-(chloromethyl)-4-hydroxy-4,5-dimethyloxolan-2-one.
| Compound Name | (3S,4S,5S)-3-chloro-5-(chloromethyl)-4-hydroxy-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 131014501 |
| Molecular Formula | C7H10Cl2O3 |
| Molecular Weight | 213.06 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | (3S,4S,5S)-3-chloro-5-(chloromethyl)-4-hydroxy-4,5-dimethyloxolan-2-one |
| SMILES | C[C@]1(CCl)OC(=O)[C@@H](Cl)[C@@]1(C)O |
| InChI | InChI=1S/C7H10Cl2O3/c1-6(3-8)7(2,11)4(9)5(10)12-6/h4,11H,3H2,1-2H3/t4-,6-,7-/m1/s1 |
| InChIKey | OCALLHZPBZJRLM-QPPQHZFASA-N |
| XLogP | 0.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.06 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|