C8H9Cl3O3 — CID 10801286
(1S,5R,7S)-6,6,7-trichloro-5-hydroxy-1,3-dimethyl-2-oxabicyclo[3.2.0]heptan-4-one (PubChem CID 10801286) has the molecular formula C8H9Cl3O3 and a molecular weight of 259.52 g/mol. Its IUPAC name is (1S,5R,7S)-6,6,7-trichloro-5-hydroxy-1,3-dimethyl-2-oxabicyclo[3.2.0]heptan-4-one.
| Compound Name | (1S,5R,7S)-6,6,7-trichloro-5-hydroxy-1,3-dimethyl-2-oxabicyclo[3.2.0]heptan-4-one |
|---|---|
| PubChem CID | 10801286 |
| Molecular Formula | C8H9Cl3O3 |
| Molecular Weight | 259.52 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | (1S,5R,7S)-6,6,7-trichloro-5-hydroxy-1,3-dimethyl-2-oxabicyclo[3.2.0]heptan-4-one |
| SMILES | CC1O[C@]2(C)[C@H](Cl)C(Cl)(Cl)[C@]2(O)C1=O |
| InChI | InChI=1S/C8H9Cl3O3/c1-3-4(12)7(13)6(2,14-3)5(9)8(7,10)11/h3,5,13H,1-2H3/t3?,5-,6+,7-/m0/s1 |
| InChIKey | YFRMQFATNSHQLU-NVDHWSJVSA-N |
| XLogP | 1.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|