C5H8ClNO2 — CID 14698772
5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one (PubChem CID 14698772) has the molecular formula C5H8ClNO2 and a molecular weight of 149.58 g/mol. Its IUPAC name is 5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14698772 |
| Molecular Formula | C5H8ClNO2 |
| Molecular Weight | 149.58 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | 5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1(CCl)CNC(=O)O1 |
| InChI | InChI=1S/C5H8ClNO2/c1-5(2-6)3-7-4(8)9-5/h2-3H2,1H3,(H,7,8) |
| InChIKey | ODMPCNVOXKDESU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.58 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|