C8H12F3NO2 — CID 116536272
5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazolidin-2-one (PubChem CID 116536272) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 116536272 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC1(CCCC(F)(F)F)CNC(=O)O1 |
| InChI | InChI=1S/C8H12F3NO2/c1-7(5-12-6(13)14-7)3-2-4-8(9,10)11/h2-5H2,1H3,(H,12,13) |
| InChIKey | SYMYVAQCMBOLKP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |