About CID 171575890
CID 171575890 (PubChem CID 171575890) has the molecular formula C11H19F3NO
and a molecular weight of 238.27 g/mol.
Molecular Properties
| Compound Name | CID 171575890 |
| PubChem CID | 171575890 |
| Molecular Formula | C11H19F3NO |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(CCCC(F)(F)F)N1[O] |
| InChI | InChI=1S/C11H19F3NO/c1-9(2)7-8-10(3,15(9)16)5-4-6-11(12,13)14/h4-8H2,1-3H3 |
| InChIKey | NCVUZGWWWVCRFG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 23.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 171575890 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171575890?
The IUPAC name of CID 171575890 (CID 171575890) is not available.
What is the SMILES notation for CID 171575890?
The canonical SMILES for CID 171575890 is CC1(C)CCC(C)(CCCC(F)(F)F)N1[O].
What is the InChIKey of CID 171575890?
The InChIKey is NCVUZGWWWVCRFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3NO/c1-9(2)7-8-10(3,15(9)16)5-4-6-11(12,13)14/h4-8H2,1-3H3.
What are the key properties of CID 171575890?
CID 171575890 has a molecular weight of 238.27 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171575890 is sourced from PubChem (CID 171575890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).