C8H13F3O3S — CID 115515292
1,1-dioxo-3-(4,4,4-trifluorobutyl)thiolan-3-ol (PubChem CID 115515292) has the molecular formula C8H13F3O3S and a molecular weight of 246.25 g/mol. Its IUPAC name is 1,1-dioxo-3-(4,4,4-trifluorobutyl)thiolan-3-ol.
| Compound Name | 1,1-dioxo-3-(4,4,4-trifluorobutyl)thiolan-3-ol |
|---|---|
| PubChem CID | 115515292 |
| Molecular Formula | C8H13F3O3S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1,1-dioxo-3-(4,4,4-trifluorobutyl)thiolan-3-ol |
| SMILES | O=S1(=O)CCC(O)(CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C8H13F3O3S/c9-8(10,11)3-1-2-7(12)4-5-15(13,14)6-7/h12H,1-6H2 |
| InChIKey | JRZZVQIVPIRLCN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |