C6H10F3NO2S — CID 105470640
1,1-dioxo-3-(2,2,2-trifluoroethyl)thiolan-3-amine (PubChem CID 105470640) has the molecular formula C6H10F3NO2S and a molecular weight of 217.21 g/mol. Its IUPAC name is 1,1-dioxo-3-(2,2,2-trifluoroethyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-3-(2,2,2-trifluoroethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 105470640 |
| Molecular Formula | C6H10F3NO2S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1,1-dioxo-3-(2,2,2-trifluoroethyl)thiolan-3-amine |
| SMILES | NC1(CC(F)(F)F)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H10F3NO2S/c7-6(8,9)3-5(10)1-2-13(11,12)4-5/h1-4,10H2 |
| InChIKey | GOYSYYYUOCGKMI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |