C7H13F2NO2S — CID 115028281
3-(2,2-difluoropropyl)-1,1-dioxothiolan-3-amine (PubChem CID 115028281) has the molecular formula C7H13F2NO2S and a molecular weight of 213.25 g/mol. Its IUPAC name is 3-(2,2-difluoropropyl)-1,1-dioxothiolan-3-amine.
| Compound Name | 3-(2,2-difluoropropyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 115028281 |
| Molecular Formula | C7H13F2NO2S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-(2,2-difluoropropyl)-1,1-dioxothiolan-3-amine |
| SMILES | CC(F)(F)CC1(N)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13F2NO2S/c1-6(8,9)4-7(10)2-3-13(11,12)5-7/h2-5,10H2,1H3 |
| InChIKey | DXWABFYTCWAOFU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |