C9H14F2O4S — CID 115047747
3-(2,2-difluoropropyl)-1,1-dioxothiane-3-carboxylic acid (PubChem CID 115047747) has the molecular formula C9H14F2O4S and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-(2,2-difluoropropyl)-1,1-dioxothiane-3-carboxylic acid.
| Compound Name | 3-(2,2-difluoropropyl)-1,1-dioxothiane-3-carboxylic acid |
|---|---|
| PubChem CID | 115047747 |
| Molecular Formula | C9H14F2O4S |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-(2,2-difluoropropyl)-1,1-dioxothiane-3-carboxylic acid |
| SMILES | CC(F)(F)CC1(C(=O)O)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14F2O4S/c1-8(10,11)5-9(7(12)13)3-2-4-16(14,15)6-9/h2-6H2,1H3,(H,12,13) |
| InChIKey | LKSAWJYOHCRIKS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |