C9H13NO3S — CID 115338002
3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine (PubChem CID 115338002) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine.
| Compound Name | 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 115338002 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine |
| SMILES | NC1(Cc2ccco2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H13NO3S/c10-9(3-5-14(11,12)7-9)6-8-2-1-4-13-8/h1-2,4H,3,5-7,10H2 |
| InChIKey | ZJAUSFJYORDYBB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |