About 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine
3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine (PubChem CID 115338002) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 115338002 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine |
| SMILES | NC1(Cc2ccco2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H13NO3S/c10-9(3-5-14(11,12)7-9)6-8-2-1-4-13-8/h1-2,4H,3,5-7,10H2 |
| InChIKey | ZJAUSFJYORDYBB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine (CID 115338002) is 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine is NC1(Cc2ccco2)CCS(=O)(=O)C1.
What is the InChIKey of 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine?
The InChIKey is ZJAUSFJYORDYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c10-9(3-5-14(11,12)7-9)6-8-2-1-4-13-8/h1-2,4H,3,5-7,10H2.
What are the key properties of 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine?
3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine has a molecular weight of 215.27 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-ylmethyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 115338002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).