C11H13Cl2NO2S — CID 115338085
3-[(2,5-dichlorophenyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 115338085) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | 3-[(2,5-dichlorophenyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 115338085 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | NC1(Cc2cc(Cl)ccc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13Cl2NO2S/c12-9-1-2-10(13)8(5-9)6-11(14)3-4-17(15,16)7-11/h1-2,5H,3-4,6-7,14H2 |
| InChIKey | RNEOPAJYBXGRDR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |