C12H17Cl2NO2S — CID 91658712
4-[(2-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride (PubChem CID 91658712) has the molecular formula C12H17Cl2NO2S and a molecular weight of 310.25 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride.
| Compound Name | 4-[(2-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride |
|---|---|
| PubChem CID | 91658712 |
| Molecular Formula | C12H17Cl2NO2S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride |
| SMILES | Cl.NC1(Cc2ccccc2Cl)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H16ClNO2S.ClH/c13-11-4-2-1-3-10(11)9-12(14)5-7-17(15,16)8-6-12;/h1-4H,5-9,14H2;1H |
| InChIKey | XIJKZDUQNDMATC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |