C12H16ClNO2S — CID 43424910
N-[(2-chlorophenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 43424910) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43424910 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CC1(NCc2ccccc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-12(6-7-17(15,16)9-12)14-8-10-4-2-3-5-11(10)13/h2-5,14H,6-9H2,1H3 |
| InChIKey | NKJOJFAOWKIUOY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |